ChemNet > CAS > 3319-01-5 1-Cyclohexylpiperidine
3319-01-5 1-Cyclohexylpiperidine
Naam product |
1-Cyclohexylpiperidine |
Synoniemen |
1-Piperidinocyclohexane; N-cyclohexylpiperidine |
MF |
C11H21N |
Molecuulgewicht |
167.2911 |
InChI |
InChI=1/C11H21N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11H,1-10H2 |
CAS-nummer |
3319-01-5 |
EINECS |
222-016-9 |
Moleculaire Structuur |
|
Dichtheid |
0.941g/cm3 |
Kookpunt |
234.3°C at 760 mmHg |
Brekingsindex |
1.501 |
Vlampunt |
101.4°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|