ChemNet > CAS > 332-48-9 4-Fluorophenoxy-ethylbromide
332-48-9 4-Fluorophenoxy-ethylbromide
Naam product |
4-Fluorophenoxy-ethylbromide |
Synoniemen |
1-(2-Bromoethoxy)-4-fluorobenzene; 1-(1-bromoethoxy)-4-fluorobenzene |
MF |
C8H8BrFO |
Molecuulgewicht |
219.0509 |
InChI |
InChI=1/C8H8BrFO/c1-6(9)11-8-4-2-7(10)3-5-8/h2-6H,1H3 |
CAS-nummer |
332-48-9 |
Moleculaire Structuur |
|
Dichtheid |
1.483g/cm3 |
Kookpunt |
242.309°C at 760 mmHg |
Brekingsindex |
1.525 |
Vlampunt |
119.849°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|