ChemNet > CAS > 3343-59-7 3,4-Dihydroxybenzaldoxime
3343-59-7 3,4-Dihydroxybenzaldoxime
Naam product |
3,4-Dihydroxybenzaldoxime |
Synoniemen |
Benzaldehyde, 3,4-dihydroxy-, oxime; (4E)-2-hydroxy-4-[(hydroxyamino)methylidene]cyclohexa-2,5-dien-1-one |
MF |
C7H7NO3 |
Molecuulgewicht |
153.1354 |
InChI |
InChI=1/C7H7NO3/c9-6-2-1-5(4-8-11)3-7(6)10/h1-4,8,10-11H/b5-4+ |
CAS-nummer |
3343-59-7 |
Moleculaire Structuur |
|
Dichtheid |
1.672g/cm3 |
Kookpunt |
317.2°C at 760 mmHg |
Brekingsindex |
1.823 |
Vlampunt |
145.6°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|