ChemNet > CAS > 33733-73-2 3-Bromothioanisole
33733-73-2 3-Bromothioanisole
Naam product |
3-Bromothioanisole |
Synoniemen |
3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
MF |
C7H7BrOS |
Molecuulgewicht |
219.0989 |
InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
CAS-nummer |
33733-73-2 |
Moleculaire Structuur |
|
Dichtheid |
1.567g/cm3 |
Kookpunt |
278.106°C at 760 mmHg |
Brekingsindex |
1.616 |
Vlampunt |
121.995°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S23:;
S24/25:;
|
|