ChemNet > CAS > 33892-75-0 5-methoxy-1-tetralone
33892-75-0 5-methoxy-1-tetralone
Naam product |
5-methoxy-1-tetralone |
Synoniemen |
5-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one |
MF |
C7H8BrN |
Molecuulgewicht |
186.0491 |
InChI |
InChI=1/C7H8BrN/c1-6-3-2-4-7(5-8)9-6/h2-4H,5H2,1H3 |
CAS-nummer |
33892-75-0 |
EINECS |
251-723-5 |
Moleculaire Structuur |
|
Dichtheid |
1.449g/cm3 |
Smeltpunt |
87-91℃ |
Kookpunt |
209.865°C at 760 mmHg |
Brekingsindex |
1.565 |
Vlampunt |
80.724°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|