ChemNet > CAS > 33901-46-1 4-Nitrophenoxyacetonitrile
33901-46-1 4-Nitrophenoxyacetonitrile
Naam product |
4-Nitrophenoxyacetonitrile |
MF |
C8H6N2O3 |
Molecuulgewicht |
178.1448 |
InChI |
InChI=1/C8H6N2O3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,6H2 |
CAS-nummer |
33901-46-1 |
Moleculaire Structuur |
|
Dichtheid |
1.317g/cm3 |
Smeltpunt |
74-76℃ |
Kookpunt |
363.9°C at 760 mmHg |
Brekingsindex |
1.564 |
Vlampunt |
173.9°C |
Gevaarsymbolen |
|
Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|