ChemNet > CAS > 3440-99-1 5-(3-Bromophenyl)-1H-tetrazole
3440-99-1 5-(3-Bromophenyl)-1H-tetrazole
Naam product |
5-(3-Bromophenyl)-1H-tetrazole |
Synoniemen |
5-(3-bromophenyl)-2H-tetrazole |
MF |
C7H5BrN4 |
Molecuulgewicht |
225.0454 |
InChI |
InChI=1/C7H5BrN4/c8-6-3-1-2-5(4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
CAS-nummer |
3440-99-1 |
Moleculaire Structuur |
|
Dichtheid |
1.745g/cm3 |
Kookpunt |
390.7°C at 760 mmHg |
Brekingsindex |
1.653 |
Vlampunt |
190.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|