ChemNet > CAS > 352018-91-8 1-(4-cyanophenyl)-4-piperidinecarbohydrazide
352018-91-8 1-(4-cyanophenyl)-4-piperidinecarbohydrazide
Naam product |
1-(4-cyanophenyl)-4-piperidinecarbohydrazide |
Synoniemen |
1-(4-cyanophenyl)piperidine-4-carbohydrazide |
MF |
C13H16N4O |
Molecuulgewicht |
244.2923 |
InChI |
InChI=1/C13H16N4O/c14-9-10-1-3-12(4-2-10)17-7-5-11(6-8-17)13(18)16-15/h1-4,11H,5-8,15H2,(H,16,18) |
CAS-nummer |
352018-91-8 |
Moleculaire Structuur |
|
Dichtheid |
1.251g/cm3 |
Kookpunt |
528.975°C at 760 mmHg |
Brekingsindex |
1.617 |
Vlampunt |
273.715°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|