ChemNet > CAS > 355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
Naam product |
4-(isopropylamino)-3-nitrobenzonitrile |
Synoniemen |
4-[(1-methylethyl)amino]-3-nitrobenzonitrile |
MF |
C10H11N3O2 |
Molecuulgewicht |
205.2132 |
InChI |
InChI=1/C10H11N3O2/c1-7(2)12-9-4-3-8(6-11)5-10(9)13(14)15/h3-5,7,12H,1-2H3 |
CAS-nummer |
355022-17-2 |
Moleculaire Structuur |
|
Dichtheid |
1.21g/cm3 |
Smeltpunt |
113℃ |
Kookpunt |
347.4°C at 760 mmHg |
Brekingsindex |
1.56 |
Vlampunt |
163.9°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|