ChemNet > CAS > 37422-56-3 5-methyl-4-(2-thiazolylazo)resorcinol
37422-56-3 5-methyl-4-(2-thiazolylazo)resorcinol
Naam product |
5-methyl-4-(2-thiazolylazo)resorcinol |
Synoniemen |
TAO~4-(2-Thiazolylazo)orcinol |
MF |
C10H9N3O2S |
Molecuulgewicht |
235.2624 |
InChI |
InChI=1/C10H9N3O2S/c1-6-4-7(14)5-8(15)9(6)12-13-10-11-2-3-16-10/h2-5,14-15H,1H3 |
CAS-nummer |
37422-56-3 |
Moleculaire Structuur |
|
Smeltpunt |
211-213℃ |
Brekingsindex |
1.709 |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|