ChemNet > CAS > 374537-99-2 7-Amino-5-bromoindole
374537-99-2 7-Amino-5-bromoindole
Naam product |
7-Amino-5-bromoindole |
Synoniemen |
5-Bromo-7-indolamine; 5-bromo-1H-indol-7-amine |
MF |
C8H7BrN2 |
Molecuulgewicht |
211.0586 |
InChI |
InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
CAS-nummer |
374537-99-2 |
Moleculaire Structuur |
|
Dichtheid |
1.753g/cm3 |
Kookpunt |
405.6°C at 760 mmHg |
Brekingsindex |
1.779 |
Vlampunt |
199.1°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|