ChemNet > CAS > 374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
| Naam product |
4-Bromo-3-fluorobenzeneboronic acid |
| Synoniemen |
4-Bromo-3-fluorophenylboronic acid |
| MF |
C6H5BBrFO2 |
| Molecuulgewicht |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| CAS-nummer |
374790-97-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.75g/cm3 |
| Kookpunt |
314.7°C at 760 mmHg |
| Brekingsindex |
1.571 |
| Vlampunt |
144.1°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
