ChemNet > CAS > 38460-95-6 10-Undecenoyl chloride
38460-95-6 10-Undecenoyl chloride
Naam product |
10-Undecenoyl chloride |
Synoniemen |
Undecenoylchloride; ; 10-Undeconyl chloride |
MF |
C11H19ClO |
Molecuulgewicht |
202.72 |
InChI |
InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2 |
CAS-nummer |
38460-95-6 |
EINECS |
253-951-0 |
Moleculaire Structuur |
|
Dichtheid |
0.94 |
Kookpunt |
120-122℃ (10 torr) |
Brekingsindex |
1.4532-1.4552 |
Vlampunt |
93℃ |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|