ChemNet > CAS > 39115-96-3 3-Bromobenzhydrazide
39115-96-3 3-Bromobenzhydrazide
Naam product |
3-Bromobenzhydrazide |
Synoniemen |
3-Bromobenzoic hydrazide; (3-Bromobenzoyl)hydrazine; (m-Bromobenzoyl)hydrazine; 3-Bromobenzohydrazide; Benzoic acid, 3-bromo-, hydrazide; Benzoic acid, m-bromo-, hydrazide; m-Bromobenzohydrazide; m-Bromobenzoic acid hydrazide; m-Bromobenzoic hydrazide |
MF |
C7H7BrN2O |
Molecuulgewicht |
215.0473 |
InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS-nummer |
39115-96-3 |
EINECS |
254-298-4 |
Moleculaire Structuur |
|
Dichtheid |
1.615g/cm3 |
Smeltpunt |
155-156℃ |
Kookpunt |
368.5°C at 760 mmHg |
Brekingsindex |
1.615 |
Vlampunt |
176.7°C |
Gevaarsymbolen |
Xi:;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|