ChemNet > CAS > 39565-00-9 2-Acetyl-5-nitrothiophene
39565-00-9 2-Acetyl-5-nitrothiophene
Naam product |
2-Acetyl-5-nitrothiophene |
Synoniemen |
5-Nitro-2-thienyl methyl ketone; Methyl 5-nitro-2-thienyl ketone; 1-(5-nitrothiophen-2-yl)ethanone |
MF |
C6H5NO3S |
Molecuulgewicht |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
CAS-nummer |
39565-00-9 |
Moleculaire Structuur |
|
Dichtheid |
1.399g/cm3 |
Kookpunt |
268.9°C at 760 mmHg |
Brekingsindex |
1.589 |
Vlampunt |
116.4°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|