ChemNet > CAS > 39769-09-0 4,4'-Difluorobenzylideneaniline
39769-09-0 4,4'-Difluorobenzylideneaniline
Naam product |
4,4'-Difluorobenzylideneaniline |
Synoniemen |
4-fluoro-N-[(1E)-(4-fluorophenyl)methylidene]aniline |
MF |
C13H9F2N |
Molecuulgewicht |
217.2141 |
InChI |
InChI=1/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
CAS-nummer |
39769-09-0 |
Moleculaire Structuur |
|
Dichtheid |
1.11g/cm3 |
Smeltpunt |
64℃ |
Kookpunt |
307.4°C at 760 mmHg |
Brekingsindex |
1.527 |
Vlampunt |
139.7°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|