ChemNet > CAS > 39959-59-6 4-Iodobenzylamine
39959-59-6 4-Iodobenzylamine
| Naam product |
4-Iodobenzylamine |
| Synoniemen |
4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
| MF |
C7H8IN |
| Molecuulgewicht |
233.0496 |
| InChI |
InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| CAS-nummer |
39959-59-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.772g/cm3 |
| Kookpunt |
250.4°C at 760 mmHg |
| Brekingsindex |
1.644 |
| Vlampunt |
105.2°C |
| Gevaarsymbolen |
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
