ChemNet > CAS > 40763-96-0 5-Chloro-2-nitrobenzamide
40763-96-0 5-Chloro-2-nitrobenzamide
Naam product |
5-Chloro-2-nitrobenzamide |
MF |
C7H5ClN2O3 |
Molecuulgewicht |
200.5792 |
InChI |
InChI=1/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) |
CAS-nummer |
40763-96-0 |
Moleculaire Structuur |
|
Dichtheid |
1.52g/cm3 |
Smeltpunt |
157-160℃ |
Kookpunt |
301.7°C at 760 mmHg |
Brekingsindex |
1.624 |
Vlampunt |
136.3°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|