ChemNet > CAS > 4100-13-4 1,2,3-Thiadiazole-4-carboxylic acid
4100-13-4 1,2,3-Thiadiazole-4-carboxylic acid
| Naam product |
1,2,3-Thiadiazole-4-carboxylic acid |
| Synoniemen |
4-Carboxy-1,2,3-thiadiazole; 1,2,3-thiadiazole-4-carboxylate |
| MF |
C3HN2O2S |
| Molecuulgewicht |
129.1178 |
| InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-8-5-4-2/h1H,(H,6,7)/p-1 |
| CAS-nummer |
4100-13-4 |
| Moleculaire Structuur |
|
| Smeltpunt |
227-228℃ |
| Kookpunt |
322.3°C at 760 mmHg |
| Vlampunt |
148.7°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
