ChemNet > CAS > 4104-75-0 N-methyl-N-phenylthiourea
4104-75-0 N-methyl-N-phenylthiourea
Naam product |
N-methyl-N-phenylthiourea |
Synoniemen |
1-Methyl-1-phenylthiourea |
MF |
C8H10N2S |
Molecuulgewicht |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-10(8(9)11)7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,11) |
CAS-nummer |
4104-75-0 |
EINECS |
223-877-3 |
Moleculaire Structuur |
|
Dichtheid |
1.221g/cm3 |
Smeltpunt |
101℃ |
Kookpunt |
267.1°C at 760 mmHg |
Brekingsindex |
1.679 |
Vlampunt |
115.3°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S37/39:Wear suitable gloves and eye/face protection.;
|
|