ChemNet > CAS > 41186-03-2 1-(3-Methylphenyl)-piperazine
41186-03-2 1-(3-Methylphenyl)-piperazine
| Naam product |
1-(3-Methylphenyl)-piperazine |
| Synoniemen |
N-(m-Tolyl)piperazine; 1-(3-Methylphenyl)piperazine; 1-m-tolylpiperazine |
| MF |
C11H16N2 |
| Molecuulgewicht |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 |
| CAS-nummer |
41186-03-2 |
| EINECS |
255-251-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.012g/cm3 |
| Kookpunt |
321.4°C at 760 mmHg |
| Brekingsindex |
1.54 |
| Vlampunt |
154°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
