ChemNet > CAS > 41536-44-1 2-(4-Morpholino)phenol
41536-44-1 2-(4-Morpholino)phenol
Naam product |
2-(4-Morpholino)phenol |
Synoniemen |
2-Morpholinophenol; 4-(2-Hydroxyphenyl)morpholine |
MF |
C10H13NO2 |
Molecuulgewicht |
179.2157 |
InChI |
InChI=1/C10H13NO2/c12-10-4-2-1-3-9(10)11-5-7-13-8-6-11/h1-4,12H,5-8H2 |
CAS-nummer |
41536-44-1 |
Moleculaire Structuur |
|
Dichtheid |
1.186g/cm3 |
Smeltpunt |
126℃ |
Kookpunt |
315.571°C at 760 mmHg |
Brekingsindex |
1.575 |
Vlampunt |
144.652°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|