ChemNet > CAS > 4165-56-4 1,4-Dibromobenzene-d4
4165-56-4 1,4-Dibromobenzene-d4
Naam product |
1,4-Dibromobenzene-d4 |
Synoniemen |
1,4-dibromo(~2~H_4_)benzene |
MF |
C6D4Br2 |
Molecuulgewicht |
239.9286 |
InChI |
InChI=1/C6H4Br2/c7-5-1-2-6(8)4-3-5/h1-4H/i1D,2D,3D,4D |
CAS-nummer |
4165-56-4 |
Moleculaire Structuur |
|
Dichtheid |
1.969g/cm3 |
Smeltpunt |
88-90℃ |
Kookpunt |
217.9°C at 760 mmHg |
Brekingsindex |
1.599 |
Vlampunt |
89.3°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|