ChemNet > CAS > 423768-55-2 (2-morpholino-3-pyridinyl)methanol
423768-55-2 (2-morpholino-3-pyridinyl)methanol
Naam product |
(2-morpholino-3-pyridinyl)methanol |
Synoniemen |
(2-morpholin-4-ylpyridin-3-yl)methanol |
MF |
C10H14N2O2 |
Molecuulgewicht |
194.2304 |
InChI |
InChI=1/C10H14N2O2/c13-8-9-2-1-3-11-10(9)12-4-6-14-7-5-12/h1-3,13H,4-8H2 |
CAS-nummer |
423768-55-2 |
Moleculaire Structuur |
|
Dichtheid |
1.215g/cm3 |
Smeltpunt |
78℃ |
Kookpunt |
397°C at 760 mmHg |
Brekingsindex |
1.572 |
Vlampunt |
193.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|