ChemNet > CAS > 4250-77-5 6-Hydroxyflavanone
4250-77-5 6-Hydroxyflavanone
| Naam product |
6-Hydroxyflavanone |
| Synoniemen |
(2R)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; 6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| MF |
C15H12O3 |
| Molecuulgewicht |
240.254 |
| InChI |
InChI=1/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| CAS-nummer |
4250-77-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.288g/cm3 |
| Smeltpunt |
220-222℃ |
| Kookpunt |
464.3°C at 760 mmHg |
| Brekingsindex |
1.631 |
| Vlampunt |
181.2°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
