ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
Naam product |
4-Isopropylphenylacetonitrile |
Synoniemen |
[4-(propan-2-yl)phenyl]acetonitrile |
MF |
C11H13N |
Molecuulgewicht |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
CAS-nummer |
4395-87-3 |
Moleculaire Structuur |
|
Dichtheid |
0.96g/cm3 |
Kookpunt |
261.1°C at 760 mmHg |
Brekingsindex |
1.514 |
Vlampunt |
117.5°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|