ChemNet > CAS > 4358-86-5;4410-31-5 DL-Mandelamide
4358-86-5;4410-31-5 DL-Mandelamide
Naam product |
DL-Mandelamide |
Synoniemen |
Mandelamide; NSC 16603; Benzeneacetamide, alpha-hydroxy-; 2-hydroxy-2-phenylacetamide |
MF |
C8H9NO2 |
Molecuulgewicht |
151.1626 |
InChI |
InChI=1/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11) |
CAS-nummer |
4358-86-5;4410-31-5 |
Moleculaire Structuur |
|
Dichtheid |
1.246g/cm3 |
Kookpunt |
345.5°C at 760 mmHg |
Brekingsindex |
1.589 |
Vlampunt |
162.7°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|