ChemNet > CAS > 443-33-4 2-Chloro-6-fluorobenzaldoxime
443-33-4 2-Chloro-6-fluorobenzaldoxime
Naam product |
2-Chloro-6-fluorobenzaldoxime |
Synoniemen |
2-Chloro-6-fluorobenzaldehyde oxime |
MF |
C7H5ClFNO |
Molecuulgewicht |
173.5721 |
InChI |
InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
CAS-nummer |
443-33-4 |
EINECS |
207-135-6 |
Moleculaire Structuur |
|
Dichtheid |
1.32g/cm3 |
Smeltpunt |
133℃ |
Kookpunt |
238°C at 760 mmHg |
Brekingsindex |
1.533 |
Vlampunt |
97.8°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|