ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| Naam product |
2-aminothiophene-3-carbonitrile |
| Synoniemen |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| MF |
C5H4N2S |
| Molecuulgewicht |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| CAS-nummer |
4651-82-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.33g/cm3 |
| Smeltpunt |
104℃ |
| Kookpunt |
317.5°C at 760 mmHg |
| Brekingsindex |
1.627 |
| Vlampunt |
145.8°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
