ChemNet > CAS > 465513-98-8 4-(1,2,3-thiadiazol-4-yl)benzoyl chloride
465513-98-8 4-(1,2,3-thiadiazol-4-yl)benzoyl chloride
Naam product |
4-(1,2,3-thiadiazol-4-yl)benzoyl chloride |
MF |
C9H5ClN2OS |
Molecuulgewicht |
224.6668 |
InChI |
InChI=1/C9H5ClN2OS/c10-9(13)7-3-1-6(2-4-7)8-5-14-12-11-8/h1-5H |
CAS-nummer |
465513-98-8 |
Moleculaire Structuur |
|
Dichtheid |
1.43g/cm3 |
Smeltpunt |
168℃ |
Kookpunt |
368.8°C at 760 mmHg |
Brekingsindex |
1.626 |
Vlampunt |
176.9°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|