ChemNet > CAS > 4819-69-6 N-(4-Chloro-2-butynyl)phthalimide
4819-69-6 N-(4-Chloro-2-butynyl)phthalimide
Naam product |
N-(4-Chloro-2-butynyl)phthalimide |
Synoniemen |
1-Chloro-4-(N-phthalimido)-2-butyne; 2-(4-chlorobut-2-yn-1-yl)-1H-isoindole-1,3(2H)-dione |
MF |
C12H8ClNO2 |
Molecuulgewicht |
233.6504 |
InChI |
InChI=1/C12H8ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,7-8H2 |
CAS-nummer |
4819-69-6 |
Moleculaire Structuur |
|
Dichtheid |
1.391g/cm3 |
Kookpunt |
389.3°C at 760 mmHg |
Brekingsindex |
1.621 |
Vlampunt |
189.2°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|