ChemNet > CAS > 488-23-3 1,2,3,4-Tetramethylbenzene
488-23-3 1,2,3,4-Tetramethylbenzene
Naam product |
1,2,3,4-Tetramethylbenzene |
Synoniemen |
Prehenitene; 1,2,3,4-tetramethyl-benze |
MF |
C10H14 |
Molecuulgewicht |
134.2182 |
InChI |
InChI=1/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
CAS-nummer |
488-23-3 |
EINECS |
207-673-1 |
Moleculaire Structuur |
|
Dichtheid |
0.868g/cm3 |
Kookpunt |
204°C at 760 mmHg |
Brekingsindex |
1.501 |
Vlampunt |
69.7°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|