ChemNet > CAS > 4906-24-5 3-Acetoxy-2-butanone
4906-24-5 3-Acetoxy-2-butanone
Naam product |
3-Acetoxy-2-butanone |
Synoniemen |
Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
MF |
C6H10O3 |
Molecuulgewicht |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
CAS-nummer |
4906-24-5 |
Moleculaire Structuur |
|
Dichtheid |
1.012g/cm3 |
Kookpunt |
163.4°C at 760 mmHg |
Brekingsindex |
1.406 |
Vlampunt |
56.6°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|