ChemNet > CAS > 4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
Naam product |
4-Hydroxy-6-methyl-3-nitro-2-pyridone |
Synoniemen |
2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
MF |
C6H6N2O4 |
Molecuulgewicht |
170.1228 |
InChI |
InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
CAS-nummer |
4966-90-9 |
Moleculaire Structuur |
|
Dichtheid |
1.53g/cm3 |
Smeltpunt |
293-296℃ |
Kookpunt |
265.6°C at 760 mmHg |
Brekingsindex |
1.608 |
Vlampunt |
114.4°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|