ChemNet > CAS > 5033-28-3 4-chloro-N'-hydroxybenzenecarboximidamide
5033-28-3 4-chloro-N'-hydroxybenzenecarboximidamide
Naam product |
4-chloro-N'-hydroxybenzenecarboximidamide |
Synoniemen |
(Z)-4-chloro-N'-hydroxybenzamidine |
MF |
C7H7ClN2O |
Molecuulgewicht |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H,(H2,9,10) |
CAS-nummer |
5033-28-3 |
Moleculaire Structuur |
|
Dichtheid |
1.368g/cm3 |
Smeltpunt |
129℃ |
Kookpunt |
334.619°C at 760 mmHg |
Brekingsindex |
1.6 |
Vlampunt |
156.172°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|