ChemNet > CAS > 50907-21-6 5-(4-Fluorophenyl)-1H-tetrazole
50907-21-6 5-(4-Fluorophenyl)-1H-tetrazole
Naam product |
5-(4-Fluorophenyl)-1H-tetrazole |
Synoniemen |
5-(4-fluorophenyl)-2H-tetrazole |
MF |
C7H5FN4 |
Molecuulgewicht |
164.1398 |
InChI |
InChI=1/C7H5FN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
CAS-nummer |
50907-21-6 |
Moleculaire Structuur |
|
Dichtheid |
1.403g/cm3 |
Kookpunt |
322°C at 760 mmHg |
Brekingsindex |
1.591 |
Vlampunt |
148.5°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|