ChemNet > CAS > 50995-74-9 7-(diethylamino)coumarin-3-carboxylic acid
50995-74-9 7-(diethylamino)coumarin-3-carboxylic acid
| Naam product |
7-(diethylamino)coumarin-3-carboxylic acid |
| Synoniemen |
7-Diethylaminocoumarin-3-carboxylic acid; 7-(Diethylamino)-2-oxo-2H-chromene-3-carboxylic acid; 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzaldehyde |
| MF |
C14H15NO4 |
| Molecuulgewicht |
261.2732 |
| InChI |
InChI=1/C14H15NO4/c1-9-12(10(2)19-15-9)8-18-13-5-4-11(7-16)6-14(13)17-3/h4-7H,8H2,1-3H3 |
| CAS-nummer |
50995-74-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.196g/cm3 |
| Smeltpunt |
222℃ |
| Kookpunt |
438.2°C at 760 mmHg |
| Brekingsindex |
1.562 |
| Vlampunt |
218.8°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
