ChemNet > CAS > 51135-96-7 4-Benzyl-4-hydroxypiperidine
51135-96-7 4-Benzyl-4-hydroxypiperidine
Naam product |
4-Benzyl-4-hydroxypiperidine |
Synoniemen |
4-Benzyl-4-piperidinol; 4-benzylpiperidin-4-ol; 4-benzyl-4-hydroxypiperidinium |
MF |
C12H18NO |
Molecuulgewicht |
192.2769 |
InChI |
InChI=1/C12H17NO/c14-12(6-8-13-9-7-12)10-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2/p+1 |
CAS-nummer |
51135-96-7 |
EINECS |
257-003-7 |
Moleculaire Structuur |
|
Smeltpunt |
80-85℃ |
Kookpunt |
329°C at 760 mmHg |
Vlampunt |
128.4°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|