ChemNet > CAS > 513-81-5 2,3-Dimethylbutadiene-1,3
513-81-5 2,3-Dimethylbutadiene-1,3
| Naam product |
2,3-Dimethylbutadiene-1,3 |
| Synoniemen |
2,3-Dimethyl-1,3-butadiene; 2,3-dimethylbuta-1,3-diene |
| MF |
C6H10 |
| Molecuulgewicht |
82.1436 |
| InChI |
InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| CAS-nummer |
513-81-5 |
| EINECS |
208-172-0 |
| Moleculaire Structuur |
|
| Dichtheid |
0.699g/cm3 |
| Kookpunt |
68.8°C at 760 mmHg |
| Brekingsindex |
1.408 |
| Gevaarsymbolen |
|
| Risico-codes |
R11:Highly flammable.;
R65:Harmful: may cause lung damage if swallowed.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S33:Take precautionary measures against static discharges.;
S62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.;
|
|
