ChemNet > CAS > 51376-06-8 5-bromo-2,1,3-benzoxadiazole
51376-06-8 5-bromo-2,1,3-benzoxadiazole
Naam product |
5-bromo-2,1,3-benzoxadiazole |
Synoniemen |
5-bromobenzo[c][1,2,5]oxadiazole |
MF |
C6H3BrN2O |
Molecuulgewicht |
199.0048 |
InChI |
InChI=1/C6H3BrN2O/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H |
CAS-nummer |
51376-06-8 |
Moleculaire Structuur |
|
Dichtheid |
1.826g/cm3 |
Smeltpunt |
73℃ |
Kookpunt |
255.778°C at 760 mmHg |
Brekingsindex |
1.661 |
Vlampunt |
108.491°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|