ChemNet > CAS > 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
Naam product |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
MF |
C10H7ClN4 |
Molecuulgewicht |
218.6424 |
InChI |
InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
CAS-nummer |
51516-67-7 |
Moleculaire Structuur |
|
Dichtheid |
1.41g/cm3 |
Smeltpunt |
170℃ |
Kookpunt |
424.2°C at 760 mmHg |
Brekingsindex |
1.686 |
Vlampunt |
210.4°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|