ChemNet > CAS > 51605-32-4 Ethyl 4-methyl-5-imidazolecarboxylate
51605-32-4 Ethyl 4-methyl-5-imidazolecarboxylate
| Naam product |
Ethyl 4-methyl-5-imidazolecarboxylate |
| Synoniemen |
ethyl 5-methyl-1H-imidazole-4-carboxylate; ethyl 4-methyl-1H-imidazole-5-carboxylate |
| MF |
C7H10N2O2 |
| Molecuulgewicht |
154.1665 |
| InChI |
InChI=1/C7H10N2O2/c1-3-11-7(10)6-5(2)8-4-9-6/h4H,3H2,1-2H3,(H,8,9) |
| CAS-nummer |
51605-32-4 |
| EINECS |
257-315-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.171g/cm3 |
| Smeltpunt |
204-206℃ |
| Kookpunt |
323.663°C at 760 mmHg |
| Brekingsindex |
1.52 |
| Vlampunt |
149.546°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
