ChemNet > CAS > 51605-97-1 4-Amino-2-bromocumene
51605-97-1 4-Amino-2-bromocumene
Naam product |
4-Amino-2-bromocumene |
Synoniemen |
2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
MF |
C9H12BrN |
Molecuulgewicht |
214.1023 |
InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
CAS-nummer |
51605-97-1 |
Moleculaire Structuur |
|
Dichtheid |
1.355g/cm3 |
Kookpunt |
271.8°C at 760 mmHg |
Brekingsindex |
1.577 |
Vlampunt |
118.2°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|