ChemNet > CAS > 5220-49-5 3-Amino-2-cyclohexen-1-one
5220-49-5 3-Amino-2-cyclohexen-1-one
Naam product |
3-Amino-2-cyclohexen-1-one |
Synoniemen |
3-aminocyclohex-2-enone; 3-aminocyclohex-2-en-1-one; methyl 1-methyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropyrido[2,3-d]pyrimidine-5-carboxylate; (3E)-3-iminocyclohexanone; 3-AMINO-2-CYCLOHEXENE-1-ONE |
MF |
C6H9NO |
Molecuulgewicht |
111.1418 |
InChI |
InChI=1/C6H9NO/c7-5-2-1-3-6(8)4-5/h7H,1-4H2/b7-5+ |
CAS-nummer |
5220-49-5 |
EINECS |
226-014-9 |
Moleculaire Structuur |
|
Dichtheid |
1.17g/cm3 |
Kookpunt |
286.5°C at 760 mmHg |
Brekingsindex |
1.558 |
Vlampunt |
127.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|