ChemNet > CAS > 5238-27-7 2-Methylvaleryl chloride
5238-27-7 2-Methylvaleryl chloride
| Naam product |
2-Methylvaleryl chloride |
| Synoniemen |
2-Methylvaleroyl Chloride; 2-Methylpentanoyl chloride; (3Z)-4-hydroxy-4-(4-methylphenyl)-2-oxo-N-1,3-thiazol-2-ylbut-3-enamide; (2S)-2-methylpentanoyl chloride; (2R)-2-methylpentanoyl chloride |
| MF |
C6H11ClO |
| Molecuulgewicht |
134.6039 |
| InChI |
InChI=1/C6H11ClO/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| CAS-nummer |
5238-27-7 |
| EINECS |
226-035-3 |
| Moleculaire Structuur |
|
| Dichtheid |
0.986g/cm3 |
| Kookpunt |
140.4°C at 760 mmHg |
| Brekingsindex |
1.422 |
| Vlampunt |
41.1°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R10:Flammable.;
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
