ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
Naam product |
2,5-Dibromo-3,4-dinitrothiophene |
Synoniemen |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
MF |
C4Br2N2O4S |
Molecuulgewicht |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
CAS-nummer |
52431-30-8 |
Moleculaire Structuur |
|
Dichtheid |
2.459g/cm3 |
Kookpunt |
341.2°C at 760 mmHg |
Brekingsindex |
1.716 |
Vlampunt |
160.2°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|