ChemNet > CAS > 529-35-1 5,6,7,8-Tetrahydro-1-naphthol
529-35-1 5,6,7,8-Tetrahydro-1-naphthol
| Naam product |
5,6,7,8-Tetrahydro-1-naphthol |
| Synoniemen |
5,6,7,8-Tetrahydro-alpha-naphthol; 5-Hydroxytetralin; NSC 28822; Tetrahydro-alpha-naphthol; 1-Naphthalenol, 5,6,7,8-tetrahydro-; 1-Naphthol, 5,6,7,8-tetrahydro-; 5,6,7,8-tetrahydronaphthalen-1-ol |
| MF |
C10H12O |
| Molecuulgewicht |
148.2017 |
| InChI |
InChI=1/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6H2 |
| CAS-nummer |
529-35-1 |
| EINECS |
208-461-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.1g/cm3 |
| Smeltpunt |
67-71℃ |
| Kookpunt |
268.2°C at 760 mmHg |
| Brekingsindex |
1.581 |
| Vlampunt |
122.6°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
