ChemNet > CAS > 5331-91-9 5-Chloro-2-mercaptobenzothiazole
5331-91-9 5-Chloro-2-mercaptobenzothiazole
Naam product |
5-Chloro-2-mercaptobenzothiazole |
Synoniemen |
5-Chloro-2-benzothiazolethiol; 5-Chloro-2-mercaptobenzthiazol; 2(3H)-Benzothiazolethione,4-chloro-(9CI); 2-mercapto-5-chloro benzothiazole; 5-chloro-1,3-benzothiazole-2(3H)-thione |
MF |
C7H4ClNS2 |
Molecuulgewicht |
201.6964 |
InChI |
InChI=1/C7H4ClNS2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
CAS-nummer |
5331-91-9 |
EINECS |
226-235-0 |
Moleculaire Structuur |
|
Dichtheid |
1.6g/cm3 |
Smeltpunt |
198-200℃ |
Kookpunt |
333.2°C at 760 mmHg |
Brekingsindex |
1.785 |
Vlampunt |
155.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|