ChemNet > CAS > 5372-23-6 4-Cyano-5-imidazolecarboxamide
5372-23-6 4-Cyano-5-imidazolecarboxamide
Naam product |
4-Cyano-5-imidazolecarboxamide |
Synoniemen |
4-Cyano-1H-imidazole-5-carboxamide |
MF |
C5H4N4O |
Molecuulgewicht |
136.1115 |
InChI |
InChI=1/C5H4N4O/c6-1-3-4(5(7)10)9-2-8-3/h2H,(H2,7,10)(H,8,9) |
CAS-nummer |
5372-23-6 |
Moleculaire Structuur |
|
Dichtheid |
1.51g/cm3 |
Smeltpunt |
276℃ |
Kookpunt |
572.8°C at 760 mmHg |
Brekingsindex |
1.617 |
Vlampunt |
300.2°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|