ChemNet > CAS > 5425-44-5 2-phenyl-1,3-dithiane
5425-44-5 2-phenyl-1,3-dithiane
Naam product |
2-phenyl-1,3-dithiane |
Synoniemen |
m-Dithiane, 2-phenyl-; 1,3-Dithiane, 2-phenyl-; 2-Phenyl-1,3-dithiane; 2-Phenyl-m-dithiane; 5-19-01-00462 (Beilstein Handbook Reference); BRN 0130879; NSC 12763; 1,3-Dithiane, 2-phenyl- (9CI) |
MF |
C10H12S2 |
Molecuulgewicht |
196.3323 |
InChI |
InChI=1/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
CAS-nummer |
5425-44-5 |
EINECS |
226-568-1 |
Moleculaire Structuur |
|
Dichtheid |
1.157g/cm3 |
Kookpunt |
326.8°C at 760 mmHg |
Brekingsindex |
1.615 |
Vlampunt |
158.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|